191846-76-1 Usage
Description
5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE is a nitroindole derivative with the molecular formula C11H10N2O3, characterized by its yellow crystalline appearance. It is a chemical compound that serves as a valuable building block in organic synthesis and pharmaceutical research due to its unique structural properties, including the presence of a nitro group and functional methoxy and methyl groups.
Uses
Used in Pharmaceutical Research:
5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE is used as a key intermediate in pharmaceutical research for the development of new drugs and pharmaceutical products. Its nitro group plays a crucial role in the design and synthesis of novel drug candidates with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE is utilized as a versatile building block for creating a variety of chemical structures. Its methoxy and methyl functional groups contribute to its reactivity and compatibility with various synthetic routes, making it a valuable component in the synthesis of organic compounds with diverse applications.
Used in Medicinal Chemistry:
5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE is employed in medicinal chemistry as a structural motif for the design of bioactive molecules. Its unique combination of functional groups allows for the development of compounds with potential therapeutic effects, including those targeting specific biological pathways or receptors.
Used in Drug Discovery:
In drug discovery processes, 5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE serves as a starting material for the synthesis of new chemical entities with potential pharmaceutical applications. Its structural features facilitate the exploration of novel chemical space and the identification of lead compounds for further optimization and development.
Used in Chemical Libraries:
5-METHOXY-1-METHYL-4-NITROINDOLE-3-CARBOXALDEHYDE is incorporated into chemical libraries for high-throughput screening in drug discovery. Its presence in these libraries enables researchers to evaluate its potential as a precursor for the development of new therapeutic agents and to study its interactions with various biological targets.
Check Digit Verification of cas no
The CAS Registry Mumber 191846-76-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,8,4 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 191846-76:
(8*1)+(7*9)+(6*1)+(5*8)+(4*4)+(3*6)+(2*7)+(1*6)=171
171 % 10 = 1
So 191846-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O4/c1-12-5-7(6-14)10-8(12)3-4-9(17-2)11(10)13(15)16/h3-6H,1-2H3
191846-76-1Relevant articles and documents
PYRROLOBENZODIAZEPINE PRODRUGS AND ANTIBODY CONJUGATES THEREOF
-
Page/Page column 176, (2018/03/06)
The invention relates generally to pyrrolobenzodiazepine monomer and dimer prodrugs having a glutathione-activated disulfide prodrug moiety, a DT-diaphorase-activated quinone prodrug moiety or a reactive oxygen species-activated aryl boronic acid or aryl boronic ester prodrug moiety. The invention further relates to pyrrolobenzodiazepine prodrug dimer-antibody conjugates.
INDQ/NO, a bioreductively activated nitric oxide prodrug
Sharma, Kavita,Iyer, Aishwarya,Sengupta, Kundan,Chakrapani, Harinath
, p. 2636 - 2639 (2013/07/19)
The design, synthesis, and development of INDQ/NO, a novel nitric oxide (NO) prodrug targeted by a bioreductive trigger, are described. INDQ/NO, an indolequinone-diazeniumdiolate is found to be metabolized to produce NO by DT-diaphorase, a bioreductive enzyme that is overexpressed in certain cancers and hypoxic tumors. Cell-based assays revealed that INDQ/NO induces DNA damage and is a potent inhibitor of cancer cell proliferation.