39974-94-2 Usage
Uses
Used in Organic Synthesis:
5-METHOXY-1-METHYLINDOLE-3-CARBOXALDEHYDE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block for the development of new molecules with specific properties and applications.
Used in Pharmaceuticals:
In the pharmaceutical industry, 5-METHOXY-1-METHYLINDOLE-3-CARBOXALDEHYDE is utilized as a starting material for the synthesis of various drugs, particularly those targeting the central nervous system. Its structural similarity to indole-based neurotransmitters and receptors enables its use in the development of novel therapeutic agents.
Used in Agrochemicals:
5-METHOXY-1-METHYLINDOLE-3-CARBOXALDEHYDE is also employed in the agrochemical sector as a precursor for the synthesis of bioactive compounds with potential applications in pest control, plant growth regulation, and other agricultural practices. Its unique chemical properties allow for the development of targeted and effective agrochemicals.
Used in Dyestuff:
In the dyestuff industry, 5-METHOXY-1-METHYLINDOLE-3-CARBOXALDEHYDE serves as an important intermediate for the production of various dyes and pigments. Its ability to form colored compounds through chemical reactions makes it a valuable contributor to the development of new and vibrant colorants for various applications, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 39974-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,9,7 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 39974-94:
(7*3)+(6*9)+(5*9)+(4*7)+(3*4)+(2*9)+(1*4)=182
182 % 10 = 2
So 39974-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3
