100098-73-5 Usage
Hydrochloride salt
The compound is a salt formed from the reaction of the parent compound (an oxazole derivative) with hydrochloric acid, which increases its stability and solubility in water.
Chloro-nitro-phenyl group
A phenyl ring (a six-membered carbon ring with hydrogen atoms) substituted with a chlorine atom and a nitro group (-NO2), which influences the compound's reactivity and potential pharmaceutical applications.
Ethenyl group
A vinyl group (C=C) with a double bond between two carbon atoms, contributing to the compound's chemical reactivity and potential applications in drug development.
Pharmaceutical research applications
The compound has potential uses in the development of new drugs for various medical conditions due to its unique structure and properties.
Target for further study
The compound's structure and properties make it an interesting subject for further research in drug discovery and development.
Safety precautions
It is important to handle this chemical with care and in accordance with safety regulations due to its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 100098-73-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,0,9 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100098-73:
(8*1)+(7*0)+(6*0)+(5*0)+(4*9)+(3*8)+(2*7)+(1*3)=85
85 % 10 = 5
So 100098-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H13ClN2O3.ClH/c1-13(2)8-19-12(15-13)6-4-9-3-5-10(14)11(7-9)16(17)18;/h3-7H,8H2,1-2H3;1H/b6-4+;
