100142-85-6 Usage
Uses
Used in Pharmaceutical Industry:
4-(4,5-DIMETHYLTHIAZOL-2-YLAMINO)BENZOIC ACID is used as a chemical intermediate for the synthesis of various pharmaceutical compounds, particularly those with potential therapeutic applications. Its unique structure allows for the development of new drugs with specific targeting and activity profiles.
Used in Chemical Synthesis:
In the field of organic chemistry, 4-(4,5-DIMETHYLTHIAZOL-2-YLAMINO)BENZOIC ACID serves as a key building block for the preparation of 2-arylamino--4,5-dimethylthiazoles and 2-alkylamino-4,5-dimethylthiazoles. These compounds have diverse applications, including potential uses in the development of new materials, dyes, and other specialty chemicals.
Used in Research and Development:
DMTB is also utilized in research and development settings, where it can be employed to study the properties and reactivity of thiazoles and their derivatives. This can lead to a better understanding of their potential applications and the development of new synthetic methods and strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 100142-85-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,1,4 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 100142-85:
(8*1)+(7*0)+(6*0)+(5*1)+(4*4)+(3*2)+(2*8)+(1*5)=56
56 % 10 = 6
So 100142-85-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O2S/c1-7-8(2)17-12(13-7)14-10-5-3-9(4-6-10)11(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16)