100253-53-0 Usage
Uses
Used in Pharmaceutical Industry:
(5,6-DIHYDRO-4H-[1,3]THIAZIN-2-YL)-(4-ETHOXY-PHENYL)-AMINE is used as a potential therapeutic agent for various medical conditions due to its thiazine derivative nature, which is known for anti-inflammatory, antioxidant, and antimicrobial activities. Its specific biological activities and applications are under investigation in the field of medicinal chemistry and drug development.
Used in Chemical Research:
In the field of chemical research, (5,6-DIHYDRO-4H-[1,3]THIAZIN-2-YL)-(4-ETHOXY-PHENYL)-AMINE serves as a subject of study for understanding the structure-activity relationships of thiazine derivatives. This knowledge can be applied to design and synthesize new compounds with improved pharmacological properties and potential applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 100253-53-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,2,5 and 3 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100253-53:
(8*1)+(7*0)+(6*0)+(5*2)+(4*5)+(3*3)+(2*5)+(1*3)=60
60 % 10 = 0
So 100253-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2OS/c1-2-15-11-6-4-10(5-7-11)14-12-13-8-3-9-16-12/h4-7H,2-3,8-9H2,1H3,(H,13,14)
