100275-94-3 Usage
Description
2,3-Dihydro-1,4-benzodioxin-6-yl isocyanate is a chemical compound belonging to the isocyanate family, characterized by its molecular formula C9H7NO3. It features a benzodioxin ring and an isocyanate group, which contribute to its reactivity and potential applications in various industrial processes. However, due to its hazardous nature, it poses risks to human health and the environment, including respiratory sensitization, skin irritation, and potential carcinogenic properties. Therefore, strict safety measures and proper handling are essential when working with this compound.
Uses
Used in Chemical Synthesis:
2,3-Dihydro-1,4-benzodioxin-6-yl isocyanate is used as a reactive intermediate in the synthesis of various chemical compounds. Its isocyanate group allows for the formation of urea and carbamate linkages with other molecules, making it a versatile building block in organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-dihydro-1,4-benzodioxin-6-yl isocyanate is used as a key component in the development of new drugs. Its unique structure and reactivity enable the creation of novel therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Polymer Industry:
2,3-Dihydro-1,4-benzodioxin-6-yl isocyanate is utilized as a monomer in the production of polyurethanes and other polymeric materials. Its ability to form strong covalent bonds with other molecules contributes to the development of high-performance materials with desirable properties such as durability, flexibility, and resistance to various environmental factors.
Used in Coatings and Adhesives:
In the coatings and adhesives industry, 2,3-dihydro-1,4-benzodioxin-6-yl isocyanate is employed as a component in the formulation of high-quality products. Its reactivity and ability to form strong bonds with various substrates make it suitable for use in the development of coatings and adhesives with excellent adhesion, durability, and resistance to wear and tear.
Used in Pesticide Industry:
2,3-Dihydro-1,4-benzodioxin-6-yl isocyanate is used as a chemical intermediate in the synthesis of certain pesticides. Its reactivity and ability to form stable compounds with other molecules make it a valuable component in the development of effective and long-lasting pest control agents.
Check Digit Verification of cas no
The CAS Registry Mumber 100275-94-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,2,7 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 100275-94:
(8*1)+(7*0)+(6*0)+(5*2)+(4*7)+(3*5)+(2*9)+(1*4)=83
83 % 10 = 3
So 100275-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3/c11-6-10-7-1-2-8-9(5-7)13-4-3-12-8/h1-2,5H,3-4H2
