100378-73-2 Usage
General Description
2-Carboxy-1-cyclopentene-1-acetic acid, also known as carbocyclic acid, is a chemical compound with the molecular formula C8H10O3. It is a carboxylic acid that contains a cyclopentene ring and a carboxylic acid functional group. 2-Carboxy-1-cyclopentene-1-acetic acid is used in organic synthesis and pharmaceutical research as a precursor to various pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable building block for the synthesis of complex molecules. Additionally, it has potential applications in the development of new drugs and materials due to its versatile chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 100378-73-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,3,7 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 100378-73:
(8*1)+(7*0)+(6*0)+(5*3)+(4*7)+(3*8)+(2*7)+(1*3)=92
92 % 10 = 2
So 100378-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O4/c9-7(10)4-5-2-1-3-6(5)8(11)12/h1-4H2,(H,9,10)(H,11,12)
