1005474-88-3 Usage
Uses
Used in Research and Development:
5-Fluoro-6-methylpyridine-2-carboxylic acid is used as a chemical intermediate for the synthesis of various compounds in research and development activities. Its unique structure and properties make it a valuable component in the creation of new molecules with potential applications in various fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-Fluoro-6-methylpyridine-2-carboxylic acid is used as a building block for the development of new drugs. Its specific chemical properties allow it to be incorporated into the molecular structures of potential therapeutic agents, contributing to their efficacy and selectivity.
Used in Chemical Synthesis:
5-Fluoro-6-methylpyridine-2-carboxylic acid is used as a reagent in chemical synthesis processes. Its ability to participate in various chemical reactions, such as esterification, amidation, and condensation, makes it a versatile component in the synthesis of a wide range of organic compounds.
Used in Material Science:
In the field of material science, 5-Fluoro-6-methylpyridine-2-carboxylic acid is used as a component in the development of new materials with specific properties. Its incorporation into polymers, for example, can result in materials with improved thermal stability, mechanical strength, or other desirable characteristics.
Used in Analytical Chemistry:
5-Fluoro-6-methylpyridine-2-carboxylic acid is used as an analytical reagent in various analytical techniques, such as chromatography and spectroscopy. Its unique chemical properties can aid in the identification, separation, and quantification of different compounds in complex mixtures.
Check Digit Verification of cas no
The CAS Registry Mumber 1005474-88-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,5,4,7 and 4 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1005474-88:
(9*1)+(8*0)+(7*0)+(6*5)+(5*4)+(4*7)+(3*4)+(2*8)+(1*8)=123
123 % 10 = 3
So 1005474-88-3 is a valid CAS Registry Number.
InChI:InChI=1S/C7H6FNO2/c1-4-5(8)2-3-6(9-4)7(10)11/h2-3H,1H3,(H,10,11)
1005474-88-3Relevant academic research and scientific papers
SUBSTITUTED 1,5-NAPHTHYRIDINES OR QUINOLINES AS ALK5 INHIBITORS
-
, (2021/05/29)
The present disclosure provides inhibitors of activin receptor-like kinase 5 (ALK5). Also disclosed are methods to modulate the activity of ALK5 and methods of treatment of disorders mediated by ALK5.
