374633-38-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-5-fluoro-6-methylpyridine is used as an intermediate in the synthesis of various pharmaceuticals for its potential applications in the development of new drugs. Its unique structure and reactivity contribute to the creation of diverse chemical products with therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Bromo-5-fluoro-6-methylpyridine is utilized as a key intermediate in the production of various agrochemicals, such as pesticides and herbicides, due to its ability to enhance the effectiveness and selectivity of these compounds.
Used in Organic Synthesis:
2-Bromo-5-fluoro-6-methylpyridine is employed as a versatile building block in organic synthesis, allowing for the preparation of a wide range of chemical products. Its reactivity and structural features make it suitable for use in research and industrial applications, facilitating the development of novel compounds with specific properties and functions.
Used in Research Applications:
In research settings, 2-Bromo-5-fluoro-6-methylpyridine is utilized for studying its chemical properties, reactivity, and potential applications in various fields. It serves as a valuable tool for understanding the behavior of heterocyclic compounds and their role in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 374633-38-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,6,3 and 3 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 374633-38:
(8*3)+(7*7)+(6*4)+(5*6)+(4*3)+(3*3)+(2*3)+(1*8)=162
162 % 10 = 2
So 374633-38-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3
