100587-90-4 Usage
Description
Lanthanum Acetate Hydrate is a white crystalline compound with the chemical formula containing x water molecules, where x is equal to 1.5. It is derived from lanthanum, a rare earth element, and is used in various applications due to its unique chemical properties.
Uses
Used in Synthesis of Complex Compounds:
Lanthanum Acetate Hydrate is used as a precursor in the synthesis of a novel phenolate-bridged dilanthanum(III) complex. This complex has potential applications as a model for metalloproteins, which are proteins containing metal ions, and are significant in various biological processes. Additionally, this complex is valuable in both basic and applied chemistry, contributing to the understanding and development of new chemical compounds and reactions.
Used in Basic and Applied Chemistry:
Lanthanum Acetate Hydrate serves as a crucial component in the field of basic and applied chemistry. Its unique properties allow it to be utilized in the development of new chemical processes and the synthesis of various compounds with potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 100587-90-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,5,8 and 7 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 100587-90:
(8*1)+(7*0)+(6*0)+(5*5)+(4*8)+(3*7)+(2*9)+(1*0)=104
104 % 10 = 4
So 100587-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2.La.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2
100587-90-4Relevant articles and documents
Synthesis, structure, and properties of solid solutions based on bismuth ferrite
Korchagina,Ivanov,Proidakova, V. Yu.,Rush,Rybakova,Sadovskaya
, p. 568 - 573 (2009/09/24)
Solid solutions of Bi1 - x Pb x Fe1 - x Zr x O3 (x = 0.1-0.2) are synthesized by the methods of liquid-phase and modified solid-phase synthesis. Also, solid solutions of [Bi0.9(Pb0.9/