1008-49-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Methyl-5-nitro-1H-imidazole-1-acetonitrile is used as a key intermediate in the synthesis of various pharmaceuticals. Its presence in the molecular structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Methyl-5-nitro-1H-imidazole-1-acetonitrile serves as an essential building block for the production of agrochemicals. Its incorporation into the molecular structure of these compounds contributes to the development of effective pesticides and other agricultural products.
Used in Synthesis of Antiprotozoal Agents:
2-Methyl-5-nitro-1H-imidazole-1-acetonitrile is used as an intermediate in the synthesis of antiprotozoal agents. Its unique chemical properties enable the development of compounds that can effectively target and eliminate protozoan parasites, offering potential treatments for various diseases caused by these organisms.
Used in Synthesis of Antimicrobial Agents:
As an intermediate in the synthesis of antimicrobial agents, 2-Methyl-5-nitro-1H-imidazole-1-acetonitrile plays a crucial role in the development of new antibiotics and antimicrobial compounds. Its presence in the molecular structure of these agents contributes to their effectiveness in combating bacterial and fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 1008-49-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1008-49:
(6*1)+(5*0)+(4*0)+(3*8)+(2*4)+(1*9)=47
47 % 10 = 7
So 1008-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O2/c1-5-8-4-6(10(11)12)9(5)3-2-7/h4H,3H2,1H3
1008-49-7Relevant academic research and scientific papers
Synthesis and antiparasitic activities of amidinic azolated derivatives
Danan,Charon,Kirkiacharian,Bories,Loiseau
, p. 227 - 229 (2007/10/03)
A set of heterocyclic N-acetamidinium hydrochlorides were prepared from the corresponding N-acetonitriles. The antiparasitic screening showed that, while all amidines are practically inactive, some nitriles present leishmanicide properties.
