100930-00-5 Usage
General Description
H-LEU-GLY-BETANA is a synthetic peptide composed of the amino acids leucine, glycine, and beta-alanine. Leucine is an essential amino acid that plays a key role in protein synthesis and muscle building, while glycine is a non-essential amino acid that is crucial for the synthesis of important molecules such as glutathione and creatine. Beta-alanine is a non-proteinogenic amino acid that is known for its role in increasing muscle carnosine levels, which can improve exercise performance and muscle endurance. This combination of amino acids in H-LEU-GLY-BETANA suggests potential benefits for muscle building and exercise performance.
Check Digit Verification of cas no
The CAS Registry Mumber 100930-00-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,3 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 100930-00:
(8*1)+(7*0)+(6*0)+(5*9)+(4*3)+(3*0)+(2*0)+(1*0)=65
65 % 10 = 5
So 100930-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H23N3O2/c1-12(2)9-16(19)18(23)20-11-17(22)21-15-8-7-13-5-3-4-6-14(13)10-15/h3-8,10,12,16H,9,11,19H2,1-2H3,(H,20,23)(H,21,22)
