101-15-5 Usage
Uses
Used in Organic Synthesis:
4-[(4-amino-3-methylphenyl)imino]cyclohexa-2,5-dien-1-one is used as a key intermediate in the synthesis of various organic compounds due to its potential reactivity and versatility. Its unique structure allows for the formation of new chemical bonds and the creation of a wide range of products with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-[(4-amino-3-methylphenyl)imino]cyclohexa-2,5-dien-1-one is used as a building block for the development of new drugs. Its ability to participate in various chemical reactions enables the synthesis of pharmaceutical compounds with specific therapeutic properties, potentially leading to the discovery of novel treatments for various diseases and conditions.
Used in Dye Industry:
4-[(4-amino-3-methylphenyl)imino]cyclohexa-2,5-dien-1-one is used as a precursor in the production of dyes. Its reactivity and structural features make it suitable for the synthesis of dyes with specific color properties, which can be utilized in various applications such as textiles, printing, and other industries that require colorants.
Used in Material Science:
In the field of material science, 4-[(4-amino-3-methylphenyl)imino]cyclohexa-2,5-dien-1-one is used for the development of materials with specific properties. Its ability to undergo various chemical reactions allows for the creation of materials with tailored characteristics, such as improved strength, flexibility, or other desirable properties, for use in various applications.
Overall, the diverse applications of 4-[(4-amino-3-methylphenyl)imino]cyclohexa-2,5-dien-1-one highlight its importance as a versatile chemical compound with potential uses across multiple industries. Its unique structure and reactivity make it a valuable asset in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 101-15-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 101-15:
(5*1)+(4*0)+(3*1)+(2*1)+(1*5)=15
15 % 10 = 5
So 101-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O/c1-9-8-11(4-7-13(9)14)15-10-2-5-12(16)6-3-10/h2-8H,14H2,1H3
