10200-27-8 Usage
Description
4-methylpimelic acid, with the molecular formula C8H14O4, is an aliphatic carboxylic acid featuring a methyl group attached to its carbon chain. Known for its acidity and ability to donate protons, this compound serves as a versatile precursor in the synthesis of pharmaceuticals and other organic compounds, making it valuable in the chemical and pharmaceutical industries.
Uses
Used in Pharmaceutical Industry:
4-methylpimelic acid is used as a chemical precursor for the synthesis of various pharmaceuticals due to its ability to participate in chemical reactions, facilitating the creation of diverse medicinal compounds.
Used in Organic Compounds Synthesis:
In the chemical industry, 4-methylpimelic acid is utilized as a building block for synthesizing a range of organic compounds, capitalizing on its structural properties and reactivity in chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 10200-27-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,0 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10200-27:
(7*1)+(6*0)+(5*2)+(4*0)+(3*0)+(2*2)+(1*7)=28
28 % 10 = 8
So 10200-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O4/c1-6(2-4-7(9)10)3-5-8(11)12/h6H,2-5H2,1H3,(H,9,10)(H,11,12)