10219-04-2 Usage
Description
N-METHYL-N-(3-FLUOROPHENYL)-THIOCARBAMOYL CHLORIDE, with the molecular formula C8H8ClFNS, is a thioisocyanate derivative that serves as a crucial intermediate in the synthesis of various pharmaceuticals, pesticides, and other organic compounds. This colorless to light yellow liquid at room temperature is highly reactive due to its thiocarbamoyl chloride functional group, necessitating careful handling to prevent the release of toxic fumes and potential irritation to the skin, eyes, and respiratory system.
Uses
Used in Pharmaceutical Industry:
N-METHYL-N-(3-FLUOROPHENYL)-THIOCARBAMOYL CHLORIDE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its reactivity allows for the formation of diverse drug molecules, contributing to the development of new medications for treating various diseases and conditions.
Used in Pesticide Industry:
In the pesticide industry, N-METHYL-N-(3-FLUOROPHENYL)-THIOCARBAMOYL CHLORIDE is utilized as a key component in the production of certain pesticides. Its ability to form stable and effective compounds makes it valuable in creating pesticides that protect crops and control pests.
Used in Organic Compounds Synthesis:
N-METHYL-N-(3-FLUOROPHENYL)-THIOCARBAMOYL CHLORIDE is used as a versatile building block in the synthesis of a wide range of organic compounds. Its unique properties enable the creation of various chemical structures, expanding the scope of organic chemistry and its applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 10219-04-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,1 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10219-04:
(7*1)+(6*0)+(5*2)+(4*1)+(3*9)+(2*0)+(1*4)=52
52 % 10 = 2
So 10219-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClFNS/c1-11(8(9)12)7-4-2-3-6(10)5-7/h2-5H,1H3
10219-04-2Relevant articles and documents
Tertiary thiols from allylic thiocarbamates by tandem enantioselective [3,3]-sigmatropic rearrangement and stereospecific arylation
Mingat, Gaelle,Maclellan, Paul,Laars, Marju,Clayden, Jonathan
, p. 1252 - 1255 (2014/03/21)
The synthesis of tertiary thiols in enantiomerically enriched form is accomplished by lithiation of enantiomerically enriched N-aryl allylic thiocarbamates. Formation of an allyllithium derivative promotes intramolecular N to C aryl migration to the posit
