10320-97-5 Usage
Uses
Used in Medicinal Chemistry:
N-naphthyl-1,2,3,4-thiatriazol-5-amine is used as a potential pharmaceutical candidate for the development of new drugs, leveraging its unique structure and properties to target specific biological pathways or receptors.
Used in Agrochemical Development:
In the agrochemical industry, N-naphthyl-1,2,3,4-thiatriazol-5-amine is used as a potential component in the creation of new pesticides or herbicides, where its chemical properties may offer novel modes of action against pests or weeds.
Used in Organic Synthesis:
N-naphthyl-1,2,3,4-thiatriazol-5-amine serves as a building block in the synthesis of other organic compounds, contributing to the development of new chemical entities with various applications across different industries.
Used in Research:
N-naphthyl-1,2,3,4-thiatriazol-5-amine is utilized by researchers across various scientific disciplines for studying its structure, properties, and potential interactions with biological systems, which can lead to advancements in understanding its therapeutic or chemical potential.
Check Digit Verification of cas no
The CAS Registry Mumber 10320-97-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10320-97:
(7*1)+(6*0)+(5*3)+(4*2)+(3*0)+(2*9)+(1*7)=55
55 % 10 = 5
So 10320-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N4S/c1-2-6-9-8(4-1)5-3-7-10(9)12-11-13-14-15-16-11/h1-7H,(H,12,13,15)
