104314-01-4 Usage
General Description
(2Z)-3-(4-Methoxyphenyl)-2-thien-2-ylacrylic acid, also known as 3-(4-methoxyphenyl)-2-thiophen-2-ylacrylic acid, is a chemical compound with a molecular formula of C12H10O3S. (2Z)-3-(4-METHOXYPHENYL)-2-THIEN-2-YLACRYLIC ACID is a derivative of thienylacrylic acid and contains a thienyl group, a phenyl group, and a methoxy group. It is commonly used in organic synthesis and medicinal chemistry research. Its properties and potential applications are still being explored, but it has shown promising potential in various fields of study, including its use as a building block in the synthesis of pharmaceuticals and organic materials. However, further research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 104314-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,3,1 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 104314-01:
(8*1)+(7*0)+(6*4)+(5*3)+(4*1)+(3*4)+(2*0)+(1*1)=64
64 % 10 = 4
So 104314-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H12O3S/c1-17-11-6-4-10(5-7-11)9-12(14(15)16)13-3-2-8-18-13/h2-9H,1H3,(H,15,16)/p-1/b12-9+
