104386-68-7 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 4-CHLORO-3-HYDROXY-5-(METHYLTHIO)THIOPHENE-2-CARBOXYLATE is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique structure and functional groups may contribute to the development of new drugs with specific biological activities.
Used in Chemical Industry:
METHYL 4-CHLORO-3-HYDROXY-5-(METHYLTHIO)THIOPHENE-2-CARBOXYLATE is used as a chemical intermediate in the synthesis of various organic compounds. Its versatile structure allows for further functionalization and modification, making it a valuable building block in the chemical industry for the production of specialty chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 104386-68-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,3,8 and 6 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 104386-68:
(8*1)+(7*0)+(6*4)+(5*3)+(4*8)+(3*6)+(2*6)+(1*8)=117
117 % 10 = 7
So 104386-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClO3S2/c1-11-6(10)5-4(9)3(8)7(12-2)13-5/h9H,1-2H3