10440-91-2 Usage
Uses
Used in Pharmaceutical Industry:
[(1-nitro-2-naphthyl)oxy]acetic acid is used as a precursor in the synthesis of pharmaceuticals for its ability to undergo chemical reactions such as reduction and substitution, leading to the development of a diverse array of compounds with distinct properties and therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, [(1-nitro-2-naphthyl)oxy]acetic acid is utilized as a starting material for the production of various agrochemicals, capitalizing on its reactivity to create compounds that can be employed in crop protection and enhancement of agricultural yields.
Used in Chemistry Research:
[(1-nitro-2-naphthyl)oxy]acetic acid is used as a research compound in the field of chemistry to explore novel reactions and mechanisms, contributing to the advancement of chemical knowledge and the discovery of new chemical processes.
Used in Materials Science:
Within the realm of materials science, [(1-nitro-2-naphthyl)oxy]acetic acid is employed in the development of new materials, leveraging its reactive nature to engineer materials with specific properties for various applications, such as in sensors, coatings, or advanced composites.
Check Digit Verification of cas no
The CAS Registry Mumber 10440-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,4 and 0 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10440-91:
(7*1)+(6*0)+(5*4)+(4*4)+(3*0)+(2*9)+(1*1)=62
62 % 10 = 2
So 10440-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO5/c14-11(15)7-18-10-6-5-8-3-1-2-4-9(8)12(10)13(16)17/h1-6H,7H2,(H,14,15)