10441-36-8 Usage
Uses
Used in Pharmaceutical Industry:
2-[(6-Hydroxy-2-naphthalenyl)oxy]acetic Acid is used as a reagent for the preparation of antitumor agents, specifically targeting sarcoma. Its unique chemical structure allows it to interact with biological targets, potentially leading to the development of novel therapeutics for cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 10441-36-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,4 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10441-36:
(7*1)+(6*0)+(5*4)+(4*4)+(3*1)+(2*3)+(1*6)=58
58 % 10 = 8
So 10441-36-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O4/c13-10-3-1-9-6-11(16-7-12(14)15)4-2-8(9)5-10/h1-6,13H,7H2,(H,14,15)
