1044851-76-4 Usage
General Description
1-Methyl-1H-pyrazole-5-boronic acid neopentyl glycol ester is a compound consisting of a boronic acid derivative and neopentyl glycol. Boronic acids are known for their utility in organic chemistry, particularly in Suzuki-Miyaura couplings, and the neopentyl glycol ester moiety enhances the compound's solubility and stability. This chemical has potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique structure and reactivity. Its properties make it an interesting target for further research and development in the field of organic chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 1044851-76-4 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,4,4,8,5 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1044851-76:
(9*1)+(8*0)+(7*4)+(6*4)+(5*8)+(4*5)+(3*1)+(2*7)+(1*6)=144
144 % 10 = 4
So 1044851-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H15BN2O2/c1-9(2)6-13-10(14-7-9)8-4-5-11-12(8)3/h4-5H,6-7H2,1-3H3