1044851-76-4 Usage
Uses
Used in Pharmaceutical Industry:
1-Methyl-1H-pyrazole-5-boronic acid neopentyl glycol ester is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique structure and reactivity make it a promising candidate for the synthesis of novel drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 1-Methyl-1H-pyrazole-5-boronic acid neopentyl glycol ester is used as a building block for the synthesis of new agrochemicals, such as pesticides and herbicides. Its reactivity in organic chemistry allows for the creation of innovative and effective products for agricultural use.
Used in Materials Science:
1-Methyl-1H-pyrazole-5-boronic acid neopentyl glycol ester is utilized as a component in the development of advanced materials with specific properties. Its unique structure and reactivity contribute to the creation of materials with improved performance characteristics, such as enhanced stability, solubility, or reactivity.
Overall, the versatility of 1-Methyl-1H-pyrazole-5-boronic acid neopentyl glycol ester in various applications across different industries highlights its potential as a valuable compound for further research and development in the field of organic chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 1044851-76-4 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,4,4,8,5 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1044851-76:
(9*1)+(8*0)+(7*4)+(6*4)+(5*8)+(4*5)+(3*1)+(2*7)+(1*6)=144
144 % 10 = 4
So 1044851-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H15BN2O2/c1-9(2)6-13-10(14-7-9)8-4-5-11-12(8)3/h4-5H,6-7H2,1-3H3
