1047-87-6 Usage
Chemical structure
The compound has a complex chemical structure, consisting of a pyridine ring, two carboxylic acid groups, a dicarboxypropylimino group, and an ethylidene group.
Potential ligand
It is a potential ligand for metal ions, which means it can bind to metal ions and form coordination complexes.
Coordination chemistry
Due to its ability to bind metal ions, it may have applications in coordination chemistry, a subfield of chemistry that focuses on the study of metal complexes.
Biochemical applications
The compound may have potential uses in biochemistry, as it can interact with metal ions, which are often essential for the function of biological molecules.
Chelating agent
It is a potential chelating agent, which means it can form multiple bonds with a single metal ion, creating a stable complex.
Industrial applications
The compound's ability to chelate metal ions could also make it useful in various industrial applications, such as water treatment or the removal of metal contaminants.
Further research needed
More research is required to fully understand the properties and potential uses of this compound, as its complex structure and multiple functional groups may lead to a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1047-87-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,4 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1047-87:
(6*1)+(5*0)+(4*4)+(3*7)+(2*8)+(1*7)=66
66 % 10 = 6
So 1047-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2O8/c17-11(18)2-1-8(12(19)20)15-4-3-7-5-9(13(21)22)16-10(6-7)14(23)24/h3-5,8,10,15H,1-2,6H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/b4-3+/t8-,10-/m0/s1
1047-87-6Relevant articles and documents
In vitro synthesis of betaxanthins using recombinant DOPA 4,5-dioxygenase and evaluation of their radical-scavenging activities
Sekiguchi, Hiroshi,Ozeki, Yoshihiro,Sasaki, Nobuhiro
experimental part, p. 12504 - 12509 (2011/09/14)
Betalamic acid, the chromophore of betaxanthins, was enzymatically synthesized on a large scale from l-dihydroxyphenylalanine (L-DOPA) using recombinant Mirabilis jalapa DOPA 4,5-dioxygenase. After synthesis, proline was directly added to the concentrated reaction mixture to generate proline-betaxanthin. The molecular mass and nuclear magnetic resonance spectrum of the purified product were identical to those previously reported for proline-betaxanthin. Twenty-four betaxanthin species were synthesized by the condensation reaction of purified betalamic acid and amino acids or amines. An HPLC protocol was established for identifying the different betaxanthin species. Proline-, dopamine-, and γ-aminobutyric acid (GABA)-betaxanthins were prepared as representative betaxanthins under large-scale conditions, and their 1,1-diphenyl-2-picrylhydrazyl radical-scavenging activities were compared against those of known antioxidants. GABA-betaxanthin showed comparatively low activity, whereas dopamine-betaxanthin had similar activity to the red pigment betanin and the anthocyanin cyanidin 3-glucoside. Proline-betaxanthin had the highest activity of the three synthesized compounds and was similar to the flavonoid quercetin.
