104802-53-1 Usage
Uses
Used in Chemical Production:
(1r,4r)-Ethyl 4-formylcyclohexanecarboxylate is used as an intermediate in the synthesis of various chemicals for industrial applications. Its unique structure allows for the creation of a wide range of products, making it a valuable component in chemical manufacturing processes.
Used in Pharmaceutical Industry:
(1r,4r)-Ethyl 4-formylcyclohexanecarboxylate is used as a building block in the development of pharmaceutical compounds. Its versatile structure can be incorporated into drug molecules, potentially leading to the discovery of new medications with improved efficacy and reduced side effects.
Used in Material Science:
(1r,4r)-Ethyl 4-formylcyclohexanecarboxylate is used as a component in the formulation of advanced materials, such as polymers and composites. Its incorporation can enhance the properties of these materials, leading to improved performance in various applications, including electronics, automotive, and aerospace industries.
Check Digit Verification of cas no
The CAS Registry Mumber 104802-53-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,8,0 and 2 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 104802-53:
(8*1)+(7*0)+(6*4)+(5*8)+(4*0)+(3*2)+(2*5)+(1*3)=91
91 % 10 = 1
So 104802-53-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O3/c1-2-13-10(12)9-5-3-8(7-11)4-6-9/h7-9H,2-6H2,1H3
104802-53-1Relevant academic research and scientific papers
Synthesis of 1,4-Cyclohexanedimethanol, 1,4-Cyclohexanedicarboxylic Acid and 1,2-Cyclohexanedicarboxylates from Formaldehyde, Crotonaldehyde and Acrylate/Fumarate
Hu, Yancheng,Zhao, Zhitong,Liu, Yanting,Li, Guangyi,Wang, Aiqin,Cong, Yu,Zhang, Tao,Wang, Feng,Li, Ning
supporting information, p. 6901 - 6905 (2018/06/04)
Valuable polyester monomers and plasticizers—1,4-cyclohexanedimethanol (CHDM), 1,4-cyclohexanedicarboxylic acid (CHDA), and 1,2-cyclohexanedicarboxylates—have been prepared by a new strategy. The synthetic processes involve a proline-catalyzed formal [3+1+2] cycloaddition of formaldehyde, crotonaldehyde, and acrylate (or fumarate). CHDM is produced after a subsequent hydrogenation step over a commercially available Cu/Zn/Al catalyst and a one-pot hydrogenation/oxidation/hydrolysis process yields CHDA, whereas 1,2-cyclohexanedicarboxylate is obtained by a Pd/C-catalyzed tandem decarbonylation/hydrogenation step.
