104830-09-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3-iodo-4,6-dimethylpyridine is utilized as a key intermediate in the synthesis of various biologically active molecules. Its unique combination of bromine and iodine atoms on the pyridine ring enhances its reactivity, making it an essential component in the creation of complex organic compounds with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 2-bromo-3-iodo-4,6-dimethylpyridine is employed as a versatile building block for the production of complex organic compounds. Its high reactivity and the presence of halogen substituents facilitate various chemical reactions, enabling the synthesis of a wide range of molecules with diverse applications in research and industry.
Used in Agrochemicals:
2-Bromo-3-iodo-4,6-dimethylpyridine also finds application in the agrochemical industry, where it serves as a precursor for the development of new pesticides and other agrochemical products. Its unique structural features and reactivity contribute to the creation of effective and targeted agrochemicals for crop protection and management.
Used in Materials Science:
In materials science, 2-bromo-3-iodo-4,6-dimethylpyridine is used as a component in the development of novel materials with specific properties. Its reactivity and structural characteristics allow for the synthesis of materials with tailored characteristics, such as improved stability, conductivity, or other desired properties, for use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 104830-09-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,8,3 and 0 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 104830-09:
(8*1)+(7*0)+(6*4)+(5*8)+(4*3)+(3*0)+(2*0)+(1*9)=93
93 % 10 = 3
So 104830-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrIN/c1-4-3-5(2)10-7(8)6(4)9/h3H,1-2H3
104830-09-3Relevant academic research and scientific papers
Condensed Heteroaromatic Ring Systems. IV. Synthesis of Naphthyridine Derivatives by Cyclization of Aminopyridineacrylic Esters
Sakamoto, Takao,Kondo, Yoshinori,Yamanaka, Hiroshi
, p. 4764 - 4768 (2007/10/02)
The reaction of aminohalopyridines with ethyl acrylate in the presence of palladium(II)acetate and triarylphosphine gave ethyl aminopyridineacrylates.The cyclization of the resulting acrylates under basic conditions gave naphthyridinones having a carbostyril-type moiety.Keywords- intramolecular cyclization; palladium catalyst; ethyl acrylate; naphthyridinone; pyridineacrylic ester
