105-88-4 Usage
General Description
Undecanal, 2,6,10-trimethyl- is a chemical compound with the formula C15H30O. Also known as 2,6,10-trimethylundecanal, it is a colorless liquid with a strong, fruity odor. Undecanal,2,6,10-trimethyl- is commonly used in the fragrance and flavor industry as a fragrance ingredient in various products such as perfumes, soaps, and cosmetics. It is also used as a flavoring agent in food products. Additionally, it has been studied for its potential antioxidant and antimicrobial properties, making it a potential candidate for use in various industrial and pharmaceutical applications. However, further research is needed to fully understand its potential benefits and risks.
Check Digit Verification of cas no
The CAS Registry Mumber 105-88-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 105-88:
(5*1)+(4*0)+(3*5)+(2*8)+(1*8)=44
44 % 10 = 4
So 105-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H28O/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h11-14H,5-10H2,1-4H3
