10551-16-3 Usage
Uses
Used in Pharmaceutical Industry:
5-(1H-PYRROL-2-YL)-1,3,4-OXADIAZOLE-2-THIOL is used as a potential therapeutic agent for its anti-cancer, anti-inflammatory, and antimicrobial properties. Its diverse biological activities make it a valuable molecule for the development of new drugs to treat various diseases.
Used in Cancer Research:
In cancer research, 5-(1H-PYRROL-2-YL)-1,3,4-OXADIAZOLE-2-THIOL is used as a potential anti-cancer agent. Its unique structure allows it to target and inhibit specific cellular pathways involved in cancer progression, making it a promising candidate for the development of novel cancer therapies.
Used in Inflammation Management:
5-(1H-PYRROL-2-YL)-1,3,4-OXADIAZOLE-2-THIOL is used as an anti-inflammatory agent due to its ability to modulate inflammatory responses. Its potential to alleviate inflammation makes it a candidate for the treatment of various inflammatory conditions.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 5-(1H-PYRROL-2-YL)-1,3,4-OXADIAZOLE-2-THIOL is used as a potential antimicrobial agent. Its ability to target and inhibit the growth of various microorganisms makes it a promising candidate for the development of new antimicrobial drugs.
Used in Bioimaging:
5-(1H-PYRROL-2-YL)-1,3,4-OXADIAZOLE-2-THIOL is used as a fluorescent probe for bioimaging applications. Its unique fluorescent properties allow for the visualization and tracking of biological processes at the molecular level, making it a valuable tool in research and diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 10551-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,5 and 1 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10551-16:
(7*1)+(6*0)+(5*5)+(4*5)+(3*1)+(2*1)+(1*6)=63
63 % 10 = 3
So 10551-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3OS/c11-6-9-8-5(10-6)4-2-1-3-7-4/h1-3,7H,(H,9,11)
10551-16-3Relevant academic research and scientific papers
LABELLED AND UN-LABELLED METHYL-PYRROLYL-OXADIAZOLYL-DIAZABICYCLONONANE DERIVATIVES AND THEIR MEDICAL USE
-
Page/Page column 12, (2012/11/06)
The present invention relates to certain labelled or un-labelled pyrrolyl-oxadizolyl-diazabicyclononane derivatives and their medical use. Furthermore, the present invention relates to the use of said derivatives in their labelled form in diagnostic methods, in particular for in vivo receptor imaging (neuroimaging).
DIAZABICYCLONONYL OXADIAZOLE COMPOUNDS AND THEIR USE AS NICOTINIC ACETYLCHOLINE RECEPTOR MODULATORS
-
Page/Page column 15, (2011/07/07)
This invention relates to diazabicyclononyl oxadiazolyl derivatives, which are found to-be modulators of the nicotinic acetylcholine receptors. Due to their pharmacological profile the compounds of the invention may be useful for the treatment of diseases or disorders as diverse as those related to the cholinergic system of the central nervous system (CNS), the peripheral nervous system (PNS), diseases or disorders related to smooth muscle contraction, endocrine diseases or disorders, diseases or disorders related to neuro-degeneration, diseases or disorders related to inflammation, pain, and withdrawal symptoms caused by the termination of abuse of chemical substances. Ar1 represents a pyrrolyl group, optionally substituted with alkyl or halo-alkyl.
