105776-13-4 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 4,6-DIMETHOXY-2-INDOLECARBOXYLATE is used as a reactant for the nitration reactions with nitric acid in the preparation of light-dependent tumor necrosis factor-α inhibitors. This application is significant because tumor necrosis factor-α (TNF-α) is a key player in the inflammatory response and is involved in the pathogenesis of various diseases, including autoimmune disorders and cancer. By inhibiting TNF-α, METHYL 4,6-DIMETHOXY-2-INDOLECARBOXYLATE can contribute to the development of novel therapeutic strategies for these conditions.
Used in Chemical Industry:
METHYL 4,6-DIMETHOXY-2-INDOLECARBOXYLATE is used as a building block in the synthesis of various organic compounds. Its unique structure and functional groups make it a valuable component in the creation of new molecules with potential applications in different areas, such as materials science, agrochemistry, and pharmaceuticals. The versatility of METHYL 4,6-DIMETHOXY-2-INDOLECARBOXYLATE in chemical reactions allows for the development of innovative products and processes that can address various challenges in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 105776-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,7,7 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 105776-13:
(8*1)+(7*0)+(6*5)+(5*7)+(4*7)+(3*6)+(2*1)+(1*3)=124
124 % 10 = 4
So 105776-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO4/c1-15-7-4-9-8(11(5-7)16-2)6-10(13-9)12(14)17-3/h4-6,13H,1-3H3
