10598-87-5 Usage
Uses
Used in Medicinal Chemistry:
2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester is used as a precursor or intermediate in the synthesis of pharmaceutical compounds due to its ability to participate in various chemical reactions, such as amide bond formation and reduction of the nitro group, which can lead to the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester is used as a building block for the creation of more complex organic molecules. Its carbamoyl and hydrazino groups can be involved in condensation reactions, providing a pathway to synthesize a variety of organic compounds with different functionalities and properties.
Further research is necessary to explore and validate the specific applications and properties of 2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester, as its full potential in various industries may not be currently known or may be under investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 10598-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,9 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10598-87:
(7*1)+(6*0)+(5*5)+(4*9)+(3*8)+(2*8)+(1*7)=115
115 % 10 = 5
So 10598-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4O6/c1-2-19-9(15)6-13(10(11)16)12-5-7-3-4-8(20-7)14(17)18/h3-5H,2,6H2,1H3,(H2,11,16)/b12-5+
