10598-87-5 Usage
General Description
2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester is a chemical compound with a complex structure. It is an ethyl ester derivative of 2-[1-carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid, which contains a nitro group and a furan ring. 2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester is likely to have applications in medicinal chemistry and organic synthesis due to the presence of both a carbamoyl and a hydrazino group, which can participate in various chemical reactions and interactions. Further research is needed to fully understand the potential uses and properties of 2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid ethyl ester.
Check Digit Verification of cas no
The CAS Registry Mumber 10598-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,9 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10598-87:
(7*1)+(6*0)+(5*5)+(4*9)+(3*8)+(2*8)+(1*7)=115
115 % 10 = 5
So 10598-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4O6/c1-2-19-9(15)6-13(10(11)16)12-5-7-3-4-8(20-7)14(17)18/h3-5H,2,6H2,1H3,(H2,11,16)/b12-5+
