106265-08-1 Usage
Uses
Used in Organic Chemistry Research:
2-Bromooctanoyl bromide is used as an acylating agent in organic chemistry research for the synthesis of various organic compounds. Its high reactivity allows for the formation of new chemical bonds and the modification of existing ones, contributing to the development of novel chemical structures and materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-bromooctanoyl bromide is employed as a brominating agent for the synthesis of pharmaceutical compounds. Its ability to introduce bromine atoms into organic molecules can enhance the pharmacological properties of these compounds, such as their stability, solubility, and bioavailability.
Used in Chemical Synthesis:
2-Bromooctanoyl bromide is used as a key intermediate in the synthesis of various chemical products, including agrochemicals, dyes, and specialty chemicals. Its versatility as a reagent enables the production of a wide range of compounds with diverse applications.
Used in Material Science:
In the field of material science, 2-bromooctanoyl bromide is utilized for the synthesis of advanced materials with specific properties, such as polymers with tailored characteristics or functionalized surfaces. Its reactivity allows for the incorporation of bromine-containing groups into the material's structure, which can impart unique properties or improve performance.
Check Digit Verification of cas no
The CAS Registry Mumber 106265-08-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,2,6 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 106265-08:
(8*1)+(7*0)+(6*6)+(5*2)+(4*6)+(3*5)+(2*0)+(1*8)=101
101 % 10 = 1
So 106265-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H14Br2O/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6H2,1H3
106265-08-1Relevant academic research and scientific papers
Highly selective synthesis of α-bromoesters using molecular bromine catalyzed by phosphorus
Sun, Zhaoyun,Peng, Xinhua,Dong, Xiongzi,Shi, Wenwen
scheme or table, p. 929 - 930 (2012/07/30)
A series of α-bromoesters have been synthesized by applying Hell-Volhard-Zelinsky reaction catalyzed by phosphorus instead of usual phosphorus tribromide. An excellent regioselectivity to good yields are achieved at comparatively mild reaction conditions of an operational simplicity.
