107265-48-5 Usage
General Description
The chemical 4-((1,4,8,11-tetraazacyclotetradec-1-yl)methyl)benzoic acid is a complex organic compound with a benzene ring attached to a long carbon chain that contains a cyclic structure made up of nitrogen atoms. The nitrogen atoms form a complex ring structure known as tetraazacyclotetradec-1-yl. 4-((1,4,8,11-tetraazacyclotetradec-1-yl)methyl)benzoic acid is often used in medical research and pharmaceutical applications as a chelating agent, which means it can bind to metal ions and form stable complexes. It has potential applications in drug delivery systems, imaging agents for medical diagnostics, and as a contrast agent for magnetic resonance imaging (MRI). Its unique molecular structure and properties make it a valuable tool for various scientific and medical purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 107265-48-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,2,6 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 107265-48:
(8*1)+(7*0)+(6*7)+(5*2)+(4*6)+(3*5)+(2*4)+(1*8)=115
115 % 10 = 5
So 107265-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H30N4O2/c23-18(24)17-5-3-16(4-6-17)15-22-13-2-9-20-11-10-19-7-1-8-21-12-14-22/h3-6,19-21H,1-2,7-15H2,(H,23,24)
107265-48-5Relevant articles and documents
Antisense Agents Combining Strongly Bound Base-Modified Oligonucleotide and Artificial Nuclease
-
Page/Page column 21, (2008/06/13)
The present invention provides compounds having a chelating moiety and an oligonucleotide sequence wherein the oligonucleotide includes one or more modified nucleobases, such as hydroxynucleobases. The disclosed compounds are suitable for antisense therap