1076-67-1 Usage
Uses
Used in Pharmaceutical Industry:
2-Naphthalenemethanethiol is used as a reactant for the synthesis of T293452, a labeled analogue of a neuronal nitric oxide synthase (nNOS) inhibitor. 2-Naphthalenemethanethiol plays a crucial role in the development of pharmaceuticals targeting nNOS, which is an enzyme involved in various physiological and pathological processes, including neurotransmission and neurodegenerative diseases.
Additionally, as an impurity in the synthesis process, 2-Naphthalenemethanethiol may be relevant for quality control and purity assessment of the final product, ensuring the safety and efficacy of the nNOS inhibitor.
Check Digit Verification of cas no
The CAS Registry Mumber 1076-67-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,7 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1076-67:
(6*1)+(5*0)+(4*7)+(3*6)+(2*6)+(1*7)=71
71 % 10 = 1
So 1076-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10S/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8H2
