109690-44-0 Usage
Uses
Used in Organic Synthesis:
[4-[2-(4-azaniumylphenoxy)ethoxy]phenyl]azanium dichloride is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions, contributing to the formation of complex organic molecules.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, [4-[2-(4-azaniumylphenoxy)ethoxy]phenyl]azanium dichloride is used as a catalyst to enhance the efficiency of specific chemical reactions, which can lead to the production of pharmaceutical compounds.
Used in Agricultural Applications:
[4-[2-(4-azaniumylphenoxy)ethoxy]phenyl]azanium dichloride is also utilized in the agricultural sector, where it serves as a catalyst in the synthesis of various agrochemicals, such as pesticides and fertilizers, to improve their effectiveness and reduce environmental impact.
Used in Industrial Applications:
In the industrial sector, [4-[2-(4-azaniumylphenoxy)ethoxy]phenyl]azanium dichloride is employed as a catalyst in chemical processes, contributing to the production of various industrial chemicals and materials.
Used in Antimicrobial and Anti-Fungal Applications:
Due to its potential antimicrobial and antifungal properties, [4-[2-(4-azaniumylphenoxy)ethoxy]phenyl]azanium dichloride is being studied for use in applications where these properties are beneficial, such as in the development of new antimicrobial agents and treatments for fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 109690-44-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,6,9 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 109690-44:
(8*1)+(7*0)+(6*9)+(5*6)+(4*9)+(3*0)+(2*4)+(1*4)=140
140 % 10 = 0
So 109690-44-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2O2.2ClH/c15-11-1-5-13(6-2-11)17-9-10-18-14-7-3-12(16)4-8-14;;/h1-8H,9-10,15-16H2;2*1H
109690-44-0Relevant academic research and scientific papers
MESOGENIC POLYMERS. 6. TWO SERIES OF ISOMERIC POLYAZOMETHINES.
Griffin,Britt,Hung,Steele
, p. 305 - 314 (2007/10/02)
Two homologoous series of alternating rigid-flexible, main chain liquid crystalline polyimines are reported; one based on terephthaldehyde the other based on p-phenylenediamine. It was found through examination of optical microscopic, x-ray diffraction an
