109857-81-0 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-1,1-Bis(3-Methyl-2-Thienyl)-1-Butene is used as an intermediate compound for the synthesis of more complex molecules, which can be further utilized in the development of pharmaceutical drugs. Its unique structure with thiophene rings and a bromine-substituted butene group may contribute to the creation of novel drug candidates with potential therapeutic applications.
Used in Chemical Research:
4-Bromo-1,1-Bis(3-Methyl-2-Thienyl)-1-Butene is used as a research compound in various scientific studies, particularly in the field of organic chemistry. Its properties and reactivity can be investigated to understand the behavior of organobromine compounds and their potential applications in chemical synthesis or material science.
Check Digit Verification of cas no
The CAS Registry Mumber 109857-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,8,5 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 109857-81:
(8*1)+(7*0)+(6*9)+(5*8)+(4*5)+(3*7)+(2*8)+(1*1)=160
160 % 10 = 0
So 109857-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H15BrS2/c1-10-5-8-16-13(10)12(4-3-7-15)14-11(2)6-9-17-14/h4-6,8-9H,3,7H2,1-2H3
