110207-93-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Ethoxy-N,N-dimethylbenzenemethanamine serves as a crucial intermediate in the production of various pharmaceuticals. Its unique structure allows for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies.
Used in Organic Chemistry as a Reagent:
3-Ethoxy-N,N-dimethylbenzenemethanamine is utilized as a reagent in organic chemistry reactions due to its ability to participate in a variety of chemical processes. Its versatility in reactions makes it a valuable tool for synthesizing complex organic molecules.
Used in Corrosion Inhibition:
3-Ethoxy-N,N-dimethylbenzenemethanamine has been studied for its potential as a corrosion inhibitor. Its chemical properties allow it to form protective layers on metal surfaces, reducing the rate of corrosion and extending the lifespan of materials in various industries, such as automotive, aerospace, and construction.
Used in Chemical Research:
3-Ethoxy-N,N-dimethylbenzenemethanamine's unique structure and properties make it an interesting subject for chemical research. It is used to explore new reaction pathways, understand the mechanisms of organic reactions, and develop innovative applications in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 110207-93-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,2,0 and 7 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 110207-93:
(8*1)+(7*1)+(6*0)+(5*2)+(4*0)+(3*7)+(2*9)+(1*3)=67
67 % 10 = 7
So 110207-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO/c1-4-13-11-7-5-6-10(8-11)9-12(2)3/h5-8H,4,9H2,1-3H3
