110623-73-9 Usage
General Description
Epmedin B is a chemical compound that exhibits biological activity. It is derived from the desert-dwelling plant Euphorbia peplus, known for its medicinal properties. Epmedin B has been studied for its potential anti-inflammatory and anti-cancer properties. It has shown to inhibit the growth of cancer cells and reduce inflammation in animal studies. Further research is needed to fully understand the mechanisms of action and potential therapeutic applications of Epmedin B.
Check Digit Verification of cas no
The CAS Registry Mumber 110623-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,6,2 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 110623-73:
(8*1)+(7*1)+(6*0)+(5*6)+(4*2)+(3*3)+(2*7)+(1*3)=79
79 % 10 = 9
So 110623-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C38H48O19/c1-14(2)5-10-18-21(53-37-31(49)28(46)26(44)22(12-39)54-37)11-19(40)23-27(45)34(32(55-33(18)23)16-6-8-17(50-4)9-7-16)56-38-35(29(47)24(42)15(3)52-38)57-36-30(48)25(43)20(41)13-51-36/h5-9,11,15,20,22,24-26,28-31,35-44,46-49H,10,12-13H2,1-4H3/t15-,20+,22+,24-,25-,26+,28-,29+,30+,31+,35+,36-,37+,38-/m0/s1