1115-24-8 Usage
Description
CHLOROACETYL-DL-ISOLEUCINE is a chemical compound derived from the reaction of chloroacetyl chloride and DL-isoleucine, an essential amino acid. This derivative features an additional chloroacetyl group, making it a crucial intermediate in the synthesis of a variety of pharmaceuticals, agrochemicals, and other organic compounds. Its unique chemical properties also lend it potential in the development of new drugs and pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
CHLOROACETYL-DL-ISOLEUCINE is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and enhancing the production of existing ones.
Used in Agrochemical Industry:
In the agrochemical sector, CHLOROACETYL-DL-ISOLEUCINE is utilized in the manufacturing of antibacterial and antifungal agents, playing a vital role in the creation of compounds that protect crops and enhance agricultural productivity.
Used in Organic Synthesis:
CHLOROACETYL-DL-ISOLEUCINE serves as a chiral building block in organic synthesis, enabling the production of enantiomerically pure compounds, which are essential in various chemical and pharmaceutical applications due to their specific biological activities.
Used in Research and Development:
Due to its unique chemical properties, CHLOROACETYL-DL-ISOLEUCINE is employed in research and development for exploring its potential in the creation of innovative pharmaceuticals and other advanced organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 1115-24-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,1 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1115-24:
(6*1)+(5*1)+(4*1)+(3*5)+(2*2)+(1*4)=38
38 % 10 = 8
So 1115-24-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14ClNO3/c1-3-5(2)7(8(12)13)10-6(11)4-9/h5,7H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5?,7-/m0/s1
