1122-67-4 Usage
Uses
Since the provided materials do not specify the exact uses of 4-Pyrimidinol, 6-(methylamino)(6CI,7CI,8CI), it is not possible to list its applications and reasons for use in different industries. However, given its chemical properties as a pyrimidine derivative, it may have potential applications in areas such as pharmaceuticals, chemical research, or material science. Further investigation and context-specific information would be required to determine its specific uses and benefits in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1122-67-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,2 and 2 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1122-67:
(6*1)+(5*1)+(4*2)+(3*2)+(2*6)+(1*7)=44
44 % 10 = 4
So 1122-67-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O/c1-6-4-2-5(9)8-3-7-4/h2-3H,1H3,(H2,6,7,8,9)
