112626-50-3 Usage
Description
3-Azabicyclo[3.3.0]octane Hydrochloride is a chemical compound characterized by its white or almost white powder form. It is a bicyclic structure with a nitrogen atom incorporated into the ring system, which contributes to its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
3-Azabicyclo[3.3.0]octane Hydrochloride is used as a reactant for the preparation of substituted pyrimidines derivatives. These derivatives are known as novel hedgehog signaling pathway inhibitors, which play a crucial role in the development and progression of various diseases, including cancer. By targeting the hedgehog signaling pathway, these inhibitors can potentially help in the treatment of such conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-Azabicyclo[3.3.0]octane Hydrochloride serves as an important building block for the creation of more complex molecules with diverse applications. Its unique bicyclic structure and reactivity make it a valuable component in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research and Development:
3-Azabicyclo[3.3.0]octane Hydrochloride is also utilized in research and development settings, where it can be employed to study the structure-activity relationships of various compounds and to develop new methodologies for the synthesis of novel molecules. Its unique chemical properties make it an interesting candidate for exploring new reaction pathways and understanding the underlying mechanisms of various chemical transformations.
Check Digit Verification of cas no
The CAS Registry Mumber 112626-50-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,6,2 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 112626-50:
(8*1)+(7*1)+(6*2)+(5*6)+(4*2)+(3*6)+(2*5)+(1*0)=93
93 % 10 = 3
So 112626-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N.ClH/c1-2-6-4-8-5-7(6)3-1;/h6-8H,1-5H2;1H
