114724-41-3 Usage
Uses
Used in Chemical Synthesis:
2-[(2-AMINOPHENYL)THIO]BENZOIC ACID HYDROCHLORIDE is used as a key intermediate in the synthesis of various organic compounds, particularly those involving the formation of cyclic sulfonium ylides. These ylides are important in organic chemistry as they can participate in a range of reactions, such as cyclopropanation and heteroatom transfer, leading to the formation of complex molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-[(2-AMINOPHENYL)THIO]BENZOIC ACID HYDROCHLORIDE is used as a building block for the development of novel drug candidates. Its unique chemical structure allows for the design of molecules with specific biological activities, potentially targeting various diseases and medical conditions.
Used in Material Science:
2-[(2-AMINOPHENYL)THIO]BENZOIC ACID HYDROCHLORIDE can also be utilized in the development of new materials with tailored properties. Its incorporation into polymers or other materials can lead to improved characteristics, such as enhanced stability, reactivity, or selectivity in various applications.
Used in Analytical Chemistry:
As an analytical reagent, 2-[(2-AMINOPHENYL)THIO]BENZOIC ACID HYDROCHLORIDE can be employed in the detection and quantification of specific analytes. Its unique chemical properties may enable the development of new analytical methods or the improvement of existing ones, leading to more accurate and reliable measurements in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 114724-41-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,7,2 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 114724-41:
(8*1)+(7*1)+(6*4)+(5*7)+(4*2)+(3*4)+(2*4)+(1*1)=103
103 % 10 = 3
So 114724-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO2S.ClH/c14-10-6-2-4-8-12(10)17-11-7-3-1-5-9(11)13(15)16;/h1-8H,14H2,(H,15,16);1H
114724-41-3Relevant academic research and scientific papers
PROCESS FOR THE PREPARATION OF 11-(4-[2-(2-HYDROXYETHOXY)ETHYL]-I-PIPERAZINYL)DIB ENZO[b,f][l,4]THIAZEPINE
-
Page/Page column 13-14, (2010/02/15)
Disclosed is a process for the preparation of l l-(4-[2-(2-hydroxyethoxy)ethyl]-l- piperazinyl)-dibenzo[b,f][l,4]thiazepine. In the process, low-priced 2,2'-dithiosalicylic acid as starting material is subjected to bond formation reaction with l-chloro-2-
