115174-39-5 Usage
General Description
Methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate is a chemical compound with the molecular formula C12H11N3O2S. It is a thiazole derivative, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE is often used as a building block in the synthesis of pharmaceuticals and agrochemicals. It has potential biological activities and is of interest in medicinal chemistry for its potential use in drug discovery and development. Its unique structure and properties make it a valuable intermediate for the production of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 115174-39-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,7 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 115174-39:
(8*1)+(7*1)+(6*5)+(5*1)+(4*7)+(3*4)+(2*3)+(1*9)=105
105 % 10 = 5
So 115174-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2S/c1-15-10(14)8-9(16-11(12)13-8)7-5-3-2-4-6-7/h2-6H,1H3,(H2,12,13)
