115174-39-5 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE is utilized as a building block in the synthesis of pharmaceuticals due to its potential biological activities and its capacity to contribute to the development of new drugs. Its unique structure allows it to be a key component in creating molecules with therapeutic properties.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE serves as a crucial intermediate in the production of various agrochemicals. Its incorporation aids in the development of compounds that can be used in agricultural applications, such as pesticides or herbicides, leveraging its chemical properties to enhance crop protection and yield.
Used in Organic Synthesis:
METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE is also used as an intermediate in organic synthesis for the production of a diverse range of organic compounds. Its versatility in chemical reactions makes it a valuable asset in the synthesis of specialty chemicals, materials, and other complex organic molecules that may have various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 115174-39-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,7 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 115174-39:
(8*1)+(7*1)+(6*5)+(5*1)+(4*7)+(3*4)+(2*3)+(1*9)=105
105 % 10 = 5
So 115174-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2S/c1-15-10(14)8-9(16-11(12)13-8)7-5-3-2-4-6-7/h2-6H,1H3,(H2,12,13)
