115491-90-2 Usage
Uses
Used in Chemical Industry:
2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) is used as a crosslinking agent for enhancing the properties of epoxy resins, polymers, and coatings, contributing to their improved performance and durability.
Used in Manufacturing Industry:
As a curing agent, 2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) is employed in various industrial applications to facilitate the curing process of materials, ensuring their optimal hardness and stability.
Used as a Chemical Intermediate:
2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) serves as a chemical intermediate in the synthesis of other organic compounds, playing a crucial role in the development of new chemical products.
Safety Precautions:
It is essential to handle 2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) with care, as it is considered harmful if swallowed, inhaled, or if it comes into contact with the skin. Adequate safety measures and protective equipment should be employed when working with 2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) to minimize potential health risks.
Check Digit Verification of cas no
The CAS Registry Mumber 115491-90-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,4,9 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 115491-90:
(8*1)+(7*1)+(6*5)+(5*4)+(4*9)+(3*1)+(2*9)+(1*0)=122
122 % 10 = 2
So 115491-90-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O7/c1-8-3(12)10(17-6(8)15)5(14)11-4(13)9(2)7(16)18-11/h1-2H3
115491-90-2Relevant academic research and scientific papers
Denarie, Michel,Grenouillat, Denis,Malfroot, Thierry,Senet, Jean-Pierre,Sennyey, Gerard,Wolf, Patrick
, p. 5823 - 5826 (1987)
2,2'-Carbonyl bis (3,5-dioxo-4-methyl-1,2,4-oxadiazolidine) was prepared and used for the synthesis of various carbamates and dipeptides.
