1158680-87-5 Usage
Uses
Used in Pharmaceutical Research and Development:
Ethanone, 1-(7-bromo-1H-indazol-1-yl)is utilized as a building block for the synthesis of novel drugs, leveraging its unique chemical properties to contribute to the development of new therapeutic agents.
Used in Medicinal Chemistry:
Ethanone, 1-(7-bromo-1H-indazol-1-yl)serves as a pharmaceutical intermediate, playing a crucial role in the production of other chemicals that may have medicinal applications, thus enhancing the scope of drug discovery and chemical synthesis.
Used in Drug Discovery:
The structure and reactivity of Ethanone, 1-(7-bromo-1H-indazol-1-yl)make it an interesting target for further investigation in the field of drug discovery, where it may contribute to the identification and development of new pharmaceutical compounds with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 1158680-87-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,5,8,6,8 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1158680-87:
(9*1)+(8*1)+(7*5)+(6*8)+(5*6)+(4*8)+(3*0)+(2*8)+(1*7)=185
185 % 10 = 5
So 1158680-87-5 is a valid CAS Registry Number.
InChI:InChI=1S/C9H7BrN2O/c1-6(13)12-9-7(5-11-12)3-2-4-8(9)10/h2-5H,1H3
1158680-87-5Relevant academic research and scientific papers
Protected indazole boronic acid pinacolyl esters: Facile syntheses and studies of reactivities in Suzuki-Miyaura cross-coupling and hydroxydeboronation reactions
Crestey, Fran?ois,Lohou, Elodie,Stiebing, Silvia,Collot, Valérie,Rault, Sylvain
body text, p. 615 - 619 (2009/07/09)
The paper describes a rapid and efficient synthesis for the isolation of protected indazolylboronic esters. These compounds were synthesized by reaction between prepared protected haloindazoles and bis(pinacolato)diboron. The effects of solvent, temperature, reaction time, and the nature of halogen atom as well as protecting group were investigated. Additionaly, these compounds reacted either with aryl halides in a Suzuki-Miyaura cross-coupling reaction or with hydrogen peroxide in a hydroxydeboronation reaction showing the potential access to new aryl and hydroxyindazole libraries. Georg Thieme Verlag Stuttgart.
