116423-07-5 Usage
Description
3-(3,5-DIMETHYL-ISOXAZOL-4-YL)-PROPIONIC ACID is a chemical compound with the molecular formula C9H13NO3, consisting of nine carbon atoms, thirteen hydrogen atoms, one nitrogen atom, and three oxygen atoms. It features an isoxazole ring, a five-membered ring with three carbon atoms and one each of nitrogen and oxygen atoms, and a propionic acid moiety. This structure makes it a valuable component in the synthesis of pharmaceuticals and other active organic compounds, known for its stability and effectiveness in various chemical reactions.
Uses
Used in Pharmaceutical Industry:
3-(3,5-DIMETHYL-ISOXAZOL-4-YL)-PROPIONIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex molecular structures. Its isoxazole ring and propionic acid moiety facilitate the creation of new drug candidates with potential therapeutic applications.
Used in Organic Chemistry Research:
3-(3,5-DIMETHYL-ISOXAZOL-4-YL)-PROPIONIC ACID is used as a reagent in organic chemistry research to explore its reactivity and potential in forming new compounds. Its unique structure allows for the investigation of novel reaction pathways and the development of innovative synthetic methods.
Used in Active Organic Compounds Synthesis:
3-(3,5-DIMETHYL-ISOXAZOL-4-YL)-PROPIONIC ACID is used as a building block in the synthesis of active organic compounds, such as agrochemicals and specialty chemicals, due to its versatility in participating in various chemical reactions and its potential to enhance the properties of the final products.
Check Digit Verification of cas no
The CAS Registry Mumber 116423-07-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,4,2 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 116423-07:
(8*1)+(7*1)+(6*6)+(5*4)+(4*2)+(3*3)+(2*0)+(1*7)=95
95 % 10 = 5
So 116423-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3/c1-5-7(3-4-8(10)11)6(2)12-9-5/h3-4H2,1-2H3,(H,10,11)/p-1
