116530-55-3 Usage
Uses
Used in Pharmaceutical Development:
3-(3-Amino-4-bromophenyl)propanoic acid is used as a bioisostere in pharmaceuticals for its ability to mimic the properties of certain amino acids. This characteristic can be leveraged to develop new drugs with improved pharmacological profiles or to enhance the efficacy of existing medications.
Used in Organic Synthesis:
In the field of organic synthesis, 3-(3-Amino-4-bromophenyl)propanoic acid is used as a building block for the creation of various organic compounds. Its reactivity with different chemical agents allows for the formation of a wide array of products, contributing to the advancement of chemical research and the development of novel materials.
Used in Chemical Reactions:
3-(3-Amino-4-bromophenyl)propanoic acid is utilized in various chemical reactions due to its functional groups, which can participate in acid-base reactions, nucleophilic and electrophilic substitutions, and other types of chemical transformations. This makes it a valuable component in the synthesis of complex organic molecules and the exploration of new chemical pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 116530-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,5,3 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 116530-55:
(8*1)+(7*1)+(6*6)+(5*5)+(4*3)+(3*0)+(2*5)+(1*5)=103
103 % 10 = 3
So 116530-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrNO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4,11H2,(H,12,13)
