1167056-95-2 Usage
Description
1H-Indole, 4-fluoro-7-nitrois a chemical compound with a molecular formula of C8H5FN2O2. It belongs to the indole class of organic compounds, characterized by a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing ring. The presence of a fluorine atom and a nitro group in the 4 and 7 positions, respectively, contributes to its unique chemical properties and potential applications. Its structure and reactivity make it of interest to researchers in chemical and pharmaceutical fields, and the fluorine and nitro substituents can impart specific biological activities, making 1H-Indole, 4-fluoro-7-nitroa potential candidate for drug development and medicinal chemistry research.
Uses
Used in Pharmaceutical Industry:
1H-Indole, 4-fluoro-7-nitrois used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block for the development of new drugs with specific biological activities.
Used in Chemical Research:
1H-Indole, 4-fluoro-7-nitrois used as a research compound in chemical studies. Its unique properties and reactivity make it a valuable tool for understanding the behavior of indole-based compounds and their potential applications in various chemical processes.
Used in Medicinal Chemistry Research:
1H-Indole, 4-fluoro-7-nitrois used as a potential candidate for drug development in medicinal chemistry research. The presence of a fluorine atom and a nitro group can impart specific biological activities, making it a promising compound for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1167056-95-2 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,6,7,0,5 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1167056-95:
(9*1)+(8*1)+(7*6)+(6*7)+(5*0)+(4*5)+(3*6)+(2*9)+(1*5)=162
162 % 10 = 2
So 1167056-95-2 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5FN2O2/c9-6-1-2-7(11(12)13)8-5(6)3-4-10-8/h1-4,10H
1167056-95-2Relevant articles and documents
Synthesis method of 4-fluoro-7-nitroindole or derivatives of 4-fluoro-7-nitroindole
-
Paragraph 0036; 0042-0043; 0046, (2021/02/06)
The invention is applicable to the technical field of chemical synthesis, and provides a synthesis method of 4-fluoro-7-nitroindole or derivatives thereof, which comprises the following steps: reacting 4-fluoroindole or derivatives thereof, glacial acetic acid and sodium cyanoborohydride to obtain 4-fluoroindoline or derivatives thereof, reacting the 4-fluoroindoline or derivatives thereof, glacial acetic acid and acetic anhydride to obtain N-acetyl-4-fluoroindoline or a derivative thereof, carrying out nitration reaction on N-acetyl-4-fluoroindoline or a derivative thereof to obtain N-acetyl4-fluoro-7-nitroindoline or a derivative thereof, reacting N-acetyl-4-fluorine 7-nitroindoline or derivatives thereof, sodium hydroxide and 1, 4-dioxane to obtain 4-fluoro-7-nitroindoline or derivatives thereof, and reacting 4-fluoro-7-nitroindoline or derivatives thereof, trichloromethane and manganese dioxide to obtain 4-fluoro-7-nitroindoline or derivatives thereof. The synthesis method provided by the invention is mild in reaction condition and easy to operate.
