1167056-95-2 Usage
Uses
Used in Pharmaceutical Industry:
1H-Indole, 4-fluoro-7-nitrois used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block for the development of new drugs with specific biological activities.
Used in Chemical Research:
1H-Indole, 4-fluoro-7-nitrois used as a research compound in chemical studies. Its unique properties and reactivity make it a valuable tool for understanding the behavior of indole-based compounds and their potential applications in various chemical processes.
Used in Medicinal Chemistry Research:
1H-Indole, 4-fluoro-7-nitrois used as a potential candidate for drug development in medicinal chemistry research. The presence of a fluorine atom and a nitro group can impart specific biological activities, making it a promising compound for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1167056-95-2 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,6,7,0,5 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1167056-95:
(9*1)+(8*1)+(7*6)+(6*7)+(5*0)+(4*5)+(3*6)+(2*9)+(1*5)=162
162 % 10 = 2
So 1167056-95-2 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5FN2O2/c9-6-1-2-7(11(12)13)8-5(6)3-4-10-8/h1-4,10H
1167056-95-2Relevant academic research and scientific papers
Synthesis method of 4-fluoro-7-nitroindole or derivatives of 4-fluoro-7-nitroindole
-
Paragraph 0036; 0042-0043; 0046, (2021/02/06)
The invention is applicable to the technical field of chemical synthesis, and provides a synthesis method of 4-fluoro-7-nitroindole or derivatives thereof, which comprises the following steps: reacting 4-fluoroindole or derivatives thereof, glacial acetic acid and sodium cyanoborohydride to obtain 4-fluoroindoline or derivatives thereof, reacting the 4-fluoroindoline or derivatives thereof, glacial acetic acid and acetic anhydride to obtain N-acetyl-4-fluoroindoline or a derivative thereof, carrying out nitration reaction on N-acetyl-4-fluoroindoline or a derivative thereof to obtain N-acetyl4-fluoro-7-nitroindoline or a derivative thereof, reacting N-acetyl-4-fluorine 7-nitroindoline or derivatives thereof, sodium hydroxide and 1, 4-dioxane to obtain 4-fluoro-7-nitroindoline or derivatives thereof, and reacting 4-fluoro-7-nitroindoline or derivatives thereof, trichloromethane and manganese dioxide to obtain 4-fluoro-7-nitroindoline or derivatives thereof. The synthesis method provided by the invention is mild in reaction condition and easy to operate.
