119-45-9 Usage
Uses
Used in Pharmaceutical Industry:
N-ALLYL-2-(CARBOXYMETHOXYL)BENZAMIDE is used as an intermediate in the synthesis of Merethoxylline Procaine (M225580), a mercurial diuretic. N-ALLYL-2-(CARBOXYMETHOXYL)BENZAMIDE plays a crucial role in the development of medications that can help in the treatment of various medical conditions, particularly those related to fluid retention and edema.
Check Digit Verification of cas no
The CAS Registry Mumber 119-45-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 119-45:
(5*1)+(4*1)+(3*9)+(2*4)+(1*5)=49
49 % 10 = 9
So 119-45-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO4/c1-2-7-13-12(16)9-5-3-4-6-10(9)17-8-11(14)15/h2-6H,1,7-8H2,(H,13,16)(H,14,15)
