119192-11-9 Usage
Description
1-(4-Hydroxy-benzyl)-1,2,4-triazole is a chemical compound belonging to the triazole class, known for its diverse biological activities. 1-(4-HYDROXY-BENZYL)-1,2,4-TRIAZOLE features a hydroxybenzyl group, which contributes to its potential utility in various applications, particularly in the pharmaceutical and agricultural industries. Its structure and properties make it a valuable building block for creating new molecules with specific biological or agricultural functions.
Uses
Used in Pharmaceutical Industry:
1-(4-Hydroxy-benzyl)-1,2,4-triazole is used as a key intermediate in the synthesis of potential drug candidates. Its unique structure allows for the development of new molecules with desired biological activities, making it a promising compound for pharmaceutical research and development.
Used in Agriculture:
In the agricultural sector, 1-(4-Hydroxy-benzyl)-1,2,4-triazole is utilized as an intermediate in the production of agrochemicals. Its properties make it suitable for the development of new compounds with targeted agricultural applications, such as pesticides or plant growth regulators.
Used as a Corrosion Inhibitor:
1-(4-Hydroxy-benzyl)-1,2,4-triazole has also been studied for its potential use as a corrosion inhibitor. Its ability to protect metals from corrosion demonstrates its versatility and potential for application in various industries, including manufacturing and construction.
Check Digit Verification of cas no
The CAS Registry Mumber 119192-11-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,1,9 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 119192-11:
(8*1)+(7*1)+(6*9)+(5*1)+(4*9)+(3*2)+(2*1)+(1*1)=119
119 % 10 = 9
So 119192-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O/c13-9-3-1-8(2-4-9)5-12-7-10-6-11-12/h1-4,6-7,13H,5H2
119192-11-9Relevant articles and documents
Compound
-
Page/Page column 82, (2008/06/13)
There is provided a compound of Formula I 1 wherein each T is independently selected from H, hydrocarbyl, —F—R, and a bond with one of D, E, P or Q, or together with one of P and Q forms a ring; Z is a suitable atom the valency of which is m; D, E and F are each independently of each other an optional linker group, wherein when Z is nitrogen E is other than CH2 and C═O; P, Q and R are independently of each other a ring system; and at least Q comprises a sulphamate group.