1193-76-6 Usage
Description
5-bromodihydro-24(1h3h)-pyrimidinedione, also known as 5-Bromodihydrouracil, is a chemical compound belonging to the pyrimidine family. It is characterized by the presence of a bromine atom at the 5th position and a dihydro structure. 5-bromodihydro-24(1h3h)-pyrimidinedione has been found to have potential applications in various fields due to its unique chemical properties.
Uses
Used in Research Applications:
5-bromodihydro-24(1h3h)-pyrimidinedione is predominantly used as a research agent for dihydropyrimidinase and dihydropyrimidine dehydrogenase. These enzymes are involved in the metabolism of pyrimidine compounds, and the study of their interactions with 5-Bromodihydrouracil can provide valuable insights into the mechanisms of pyrimidine metabolism and its regulation.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-bromodihydro-24(1h3h)-pyrimidinedione is used as a starting material or intermediate in the synthesis of various therapeutic agents. Its unique chemical structure allows for the development of novel drugs with potential applications in treating different diseases.
Used in Biochemical Research:
5-bromodihydro-24(1h3h)-pyrimidinedione is also utilized in biochemical research to study the structure and function of pyrimidine-based biomolecules. Its interaction with various enzymes and proteins can help researchers understand the role of pyrimidines in cellular processes and their potential as targets for therapeutic intervention.
Check Digit Verification of cas no
The CAS Registry Mumber 1193-76-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 3 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1193-76:
(6*1)+(5*1)+(4*9)+(3*3)+(2*7)+(1*6)=76
76 % 10 = 6
So 1193-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BrN2O2/c5-2-1-6-4(9)7-3(2)8/h2H,1H2,(H2,6,7,8,9)/t2-/m1/s1