1205-09-0 Usage
General Description
The chemical [(α-Methylbenzylidene)amino]oxy]acetic acid is an organic compound with the molecular formula C10H11NO3. It is a white to light yellow crystalline solid with a molecular weight of 189.20 g/mol. [[(α-Methylbenzylidene)amino]oxy]acetic acid is often used in the field of pharmaceuticals and organic synthesis. It has potential applications in medicinal chemistry, as it possesses promising biological activities such as anti-inflammatory and antitumor properties. The chemical structure of this compound includes a benzylideneamino group and an oxyacetic acid group, which contribute to its potential medicinal properties. Overall, [(α-Methylbenzylidene)amino]oxy]acetic acid is a versatile chemical with various potential applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 1205-09-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,0 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1205-09:
(6*1)+(5*2)+(4*0)+(3*5)+(2*0)+(1*9)=40
40 % 10 = 0
So 1205-09-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO3/c1-8(11-14-7-10(12)13)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,13)/b11-8-
