1218-65-1 Usage
Uses
Used in Organic Chemistry:
Bicyclo[2.2.1]hept-5-en-2-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate serves as a key building block and intermediate in the synthesis of various organic compounds. Its presence in organic chemistry is attributed to its ability to participate in reactions such as hydrogenation, hydrolysis, and acylation, which are crucial for constructing complex molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, bicyclo[2.2.1]hept-5-en-2-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is employed as a precursor for the development of novel drug molecules. Its unique bicyclic structure and functional groups make it an ideal candidate for the synthesis of bioactive compounds with potential therapeutic applications.
Used in Agrochemical Industry:
Bicyclo[2.2.1]hept-5-en-2-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate also finds application in the agrochemical industry, where it is used as a starting material for the synthesis of new agrochemicals. Its reactivity and structural features contribute to the development of innovative products with improved performance in agricultural applications.
Used in Materials Science:
In the realm of materials science, bicyclo[2.2.1]hept-5-en-2-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is utilized for the synthesis of advanced materials with unique properties. Its incorporation into material formulations can lead to the development of new materials with enhanced characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 1218-65-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,1 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1218-65:
(6*1)+(5*2)+(4*1)+(3*8)+(2*6)+(1*5)=61
61 % 10 = 1
So 1218-65-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H20O2/c17-16(15-8-11-2-4-13(15)6-11)18-9-14-7-10-1-3-12(14)5-10/h1-4,10-15H,5-9H2
1218-65-1Relevant academic research and scientific papers
Aluminum trisphenoxide polymer as a Lewis acidic, solid catalyst
Saito, Susumu,Murase, Masaaki,Yamamoto, Hisashi
, p. 57 - 58 (2007/10/03)
A newly introduced, solid polymer of an aluminum trisphenoxide has been demonstrated an efficient catalyst for promoting the Diels-Alder reaction of α,β-enals.
